C19H16F3N3O2 — CID 90465420
1-phenyl-5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 90465420) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-phenyl-5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-phenyl-5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90465420 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-phenyl-5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccc(COCC(F)(F)F)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)12-27-11-13-5-4-6-14(9-13)17-10-16(18(23)26)24-25(17)15-7-2-1-3-8-15/h1-10H,11-12H2,(H2,23,26) |
| InChIKey | CYKIJLGFLDYDDV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |