C32H36O4 — CID 10576843
1,2,3,4-tetrahydronaphthalen-2-ylmethyl 3-[(13S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]prop-2-ynoate (PubChem CID 10576843) has the molecular formula C32H36O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-ylmethyl 3-[(13S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]prop-2-ynoate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-ylmethyl 3-[(13S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 10576843 |
| Molecular Formula | C32H36O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-ylmethyl 3-[(13S,17S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]prop-2-ynoate |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@@]2(O)C#CC(=O)OCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C32H36O4/c1-31-15-12-27-26-11-9-25(33)19-24(26)8-10-28(27)29(31)13-16-32(31,35)17-14-30(34)36-20-21-6-7-22-4-2-3-5-23(22)18-21/h2-5,9,11,19,21,27-29,33,35H,6-8,10,12-13,15-16,18,20H2,1H3/t21?,27?,28?,29?,31-,32+/m0/s1 |
| InChIKey | LGRXDRVHOWVXAF-LJZSCWKOSA-N |
| XLogP | 5.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|