C23H44N4O5Si — CID 10576854
tert-butyl (2S,4R)-2-[1-azido-3-(oxan-2-yloxy)propan-2-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 10576854) has the molecular formula C23H44N4O5Si and a molecular weight of 484.71 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[1-azido-3-(oxan-2-yloxy)propan-2-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[1-azido-3-(oxan-2-yloxy)propan-2-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10576854 |
| Molecular Formula | C23H44N4O5Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | tert-butyl (2S,4R)-2-[1-azido-3-(oxan-2-yloxy)propan-2-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(CN=[N+]=[N-])COC1CCCCO1 |
| InChI | InChI=1S/C23H44N4O5Si/c1-22(2,3)31-21(28)27-15-18(32-33(7,8)23(4,5)6)13-19(27)17(14-25-26-24)16-30-20-11-9-10-12-29-20/h17-20H,9-16H2,1-8H3/t17?,18-,19+,20?/m1/s1 |
| InChIKey | JFDXRLLPEQBYAB-KAXARAQCSA-N |
| XLogP | 5.86 |
| TPSA | 105.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|