C27H34O8 — CID 10576898
[(1S,2S,6S,7S,9R,12R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-12-yl] 3-methylbut-2-enoate (PubChem CID 10576898) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is [(1S,2S,6S,7S,9R,12R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-12-yl] 3-methylbut-2-enoate.
| Compound Name | [(1S,2S,6S,7S,9R,12R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-12-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10576898 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [(1S,2S,6S,7S,9R,12R,13R,17S)-4,15-dimethoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-12-yl] 3-methylbut-2-enoate |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3OC(=O)[C@H](OC(=O)C=C(C)C)[C@H]4C(C)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@]43C |
| InChI | InChI=1S/C27H34O8/c1-12(2)9-18(28)35-22-19-14(4)21(33-8)20(29)23-26(5)15(13(3)10-16(32-7)24(26)30)11-17(27(19,23)6)34-25(22)31/h9-10,13,15,17,19,22-23H,11H2,1-8H3/t13-,15+,17-,19-,22-,23-,26+,27+/m1/s1 |
| InChIKey | WFBUKJCGLZQUOX-GXNZPPCNSA-N |
| XLogP | 3.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|