C28H30O7 — CID 10719434
[(1S,2S,6S,7S,9R,13R,17S)-15-methoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-4-yl] benzoate (PubChem CID 10719434) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is [(1S,2S,6S,7S,9R,13R,17S)-15-methoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-4-yl] benzoate.
| Compound Name | [(1S,2S,6S,7S,9R,13R,17S)-15-methoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-4-yl] benzoate |
|---|---|
| PubChem CID | 10719434 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(1S,2S,6S,7S,9R,13R,17S)-15-methoxy-2,6,14,17-tetramethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-dien-4-yl] benzoate |
| SMILES | COC1=C(C)[C@@H]2CC(=O)O[C@@H]3C[C@H]4[C@H](C)C=C(OC(=O)c5ccccc5)C(=O)[C@]4(C)[C@@H](C1=O)[C@@]32C |
| InChI | InChI=1S/C28H30O7/c1-14-11-19(34-26(32)16-9-7-6-8-10-16)25(31)28(4)17(14)12-20-27(3)18(13-21(29)35-20)15(2)23(33-5)22(30)24(27)28/h6-11,14,17-18,20,24H,12-13H2,1-5H3/t14-,17+,18+,20-,24+,27-,28+/m1/s1 |
| InChIKey | DFBOERPLAOGQOO-LSYQYPONSA-N |
| XLogP | 4.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |