C21H26O6 — CID 163010722
(1R,2R,6S,7R,9R,13S,17S)-4-hydroxy-15-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione (PubChem CID 163010722) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1R,2R,6S,7R,9R,13S,17S)-4-hydroxy-15-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione.
| Compound Name | (1R,2R,6S,7R,9R,13S,17S)-4-hydroxy-15-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
|---|---|
| PubChem CID | 163010722 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1R,2R,6S,7R,9R,13S,17S)-4-hydroxy-15-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
| SMILES | COC1=C(C)[C@H]2CC(=O)O[C@@H]3C[C@@H]4[C@H](C)C=C(O)C(=O)[C@@]4(C)[C@H](C1=O)[C@]23C |
| InChI | InChI=1S/C21H26O6/c1-9-6-13(22)19(25)21(4)11(9)7-14-20(3)12(8-15(23)27-14)10(2)17(26-5)16(24)18(20)21/h6,9,11-12,14,18,22H,7-8H2,1-5H3/t9-,11-,12-,14-,18-,20-,21-/m1/s1 |
| InChIKey | IBDCZBYIEPTNQQ-OCNCBGBLSA-N |
| XLogP | 2.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |