C25H45BN4O3Si — CID 10576955
(3R,4S)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile (PubChem CID 10576955) has the molecular formula C25H45BN4O3Si and a molecular weight of 488.56 g/mol. Its IUPAC name is (3R,4S)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile.
| Compound Name | (3R,4S)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 10576955 |
| Molecular Formula | C25H45BN4O3Si |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (3R,4S)-4-azido-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]pentanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N=[N+]=[N-])[C@@H](CC#N)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C25H45BN4O3Si/c1-25(2,3)34(4,5)31-18-22(29-30-28)21(16-17-27)26-32-23(19-12-8-6-9-13-19)24(33-26)20-14-10-7-11-15-20/h19-24H,6-16,18H2,1-5H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | VBXULQMFDQUONR-LWSSLDFYSA-N |
| XLogP | 7.40 |
| TPSA | 100.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|