C26H46BBrN4O3Si — CID 10603343
(3R,4S)-4-azido-3-[(R)-bromo-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-5-[tert-butyl(dimethyl)silyl]oxypentanenitrile (PubChem CID 10603343) has the molecular formula C26H46BBrN4O3Si and a molecular weight of 581.48 g/mol. Its IUPAC name is (3R,4S)-4-azido-3-[(R)-bromo-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-5-[tert-butyl(dimethyl)silyl]oxypentanenitrile.
| Compound Name | (3R,4S)-4-azido-3-[(R)-bromo-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-5-[tert-butyl(dimethyl)silyl]oxypentanenitrile |
|---|---|
| PubChem CID | 10603343 |
| Molecular Formula | C26H46BBrN4O3Si |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (3R,4S)-4-azido-3-[(R)-bromo-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]methyl]-5-[tert-butyl(dimethyl)silyl]oxypentanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N=[N+]=[N-])[C@@H](CC#N)[C@H](Br)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C26H46BBrN4O3Si/c1-26(2,3)36(4,5)33-18-22(31-32-30)21(16-17-29)25(28)27-34-23(19-12-8-6-9-13-19)24(35-27)20-14-10-7-11-15-20/h19-25H,6-16,18H2,1-5H3/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | VTDFYPLSEMKLTN-VAFBSOEGSA-N |
| XLogP | 7.95 |
| TPSA | 100.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|