C23H43BBrN3O3Si — CID 10602231
[(2R,3R)-2-azido-3-bromo-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]propoxy]-tert-butyl-dimethylsilane (PubChem CID 10602231) has the molecular formula C23H43BBrN3O3Si and a molecular weight of 528.42 g/mol. Its IUPAC name is [(2R,3R)-2-azido-3-bromo-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]propoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-2-azido-3-bromo-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]propoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10602231 |
| Molecular Formula | C23H43BBrN3O3Si |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | [(2R,3R)-2-azido-3-bromo-3-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]propoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N=[N+]=[N-])[C@H](Br)B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C23H43BBrN3O3Si/c1-23(2,3)32(4,5)29-16-19(27-28-26)22(25)24-30-20(17-12-8-6-9-13-17)21(31-24)18-14-10-7-11-15-18/h17-22H,6-16H2,1-5H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | YPKNSVPKBBJMEJ-MLNNCEHLSA-N |
| XLogP | 7.42 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|