C22H42BN3O3Si — CID 10788998
[(2S)-2-azido-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-tert-butyl-dimethylsilane (PubChem CID 10788998) has the molecular formula C22H42BN3O3Si and a molecular weight of 435.49 g/mol. Its IUPAC name is [(2S)-2-azido-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S)-2-azido-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10788998 |
| Molecular Formula | C22H42BN3O3Si |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | [(2S)-2-azido-2-[(4S,5S)-4,5-dicyclohexyl-1,3,2-dioxaborolan-2-yl]ethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](N=[N+]=[N-])B1O[C@@H](C2CCCCC2)[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C22H42BN3O3Si/c1-22(2,3)30(4,5)27-16-19(25-26-24)23-28-20(17-12-8-6-9-13-17)21(29-23)18-14-10-7-11-15-18/h17-21H,6-16H2,1-5H3/t19-,20+,21+/m1/s1 |
| InChIKey | KGHIILKLLDCXPT-HKBOAZHASA-N |
| XLogP | 6.66 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|