C36H44N2O2 — CID 10578287
methyl 4-(5-heptyl-7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate (PubChem CID 10578287) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is methyl 4-(5-heptyl-7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate.
| Compound Name | methyl 4-(5-heptyl-7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate |
|---|---|
| PubChem CID | 10578287 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | methyl 4-(5-heptyl-7,7,10,10-tetramethyl-8,9-dihydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate |
| SMILES | CCCCCCCN1c2ccccc2N=C(c2ccc(C(=O)OC)cc2)c2cc3c(cc21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C36H44N2O2/c1-7-8-9-10-13-22-38-31-15-12-11-14-30(31)37-33(25-16-18-26(19-17-25)34(39)40-6)27-23-28-29(24-32(27)38)36(4,5)21-20-35(28,2)3/h11-12,14-19,23-24H,7-10,13,20-22H2,1-6H3 |
| InChIKey | KTYCOQZZEBVOQS-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|