C29H33NO2 — CID 10025561
methyl 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoate (PubChem CID 10025561) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is methyl 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoate.
| Compound Name | methyl 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoate |
|---|---|
| PubChem CID | 10025561 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | methyl 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cn(C)c3c2CCc2cc4c(cc2-3)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C29H33NO2/c1-28(2)13-14-29(3,4)25-16-22-20(15-24(25)28)11-12-21-23(17-30(5)26(21)22)18-7-9-19(10-8-18)27(31)32-6/h7-10,15-17H,11-14H2,1-6H3 |
| InChIKey | HQSZJSTYOCTVNS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |