C27H32O4 — CID 10251583
methyl 4-[hydroxy-(5,5,8,8-tetramethyl-1-oxo-3,4,6,7-tetrahydro-2H-anthracen-2-yl)methyl]benzoate (PubChem CID 10251583) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl 4-[hydroxy-(5,5,8,8-tetramethyl-1-oxo-3,4,6,7-tetrahydro-2H-anthracen-2-yl)methyl]benzoate.
| Compound Name | methyl 4-[hydroxy-(5,5,8,8-tetramethyl-1-oxo-3,4,6,7-tetrahydro-2H-anthracen-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 10251583 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl 4-[hydroxy-(5,5,8,8-tetramethyl-1-oxo-3,4,6,7-tetrahydro-2H-anthracen-2-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C(O)C2CCc3cc4c(cc3C2=O)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C27H32O4/c1-26(2)12-13-27(3,4)22-15-20-18(14-21(22)26)10-11-19(24(20)29)23(28)16-6-8-17(9-7-16)25(30)31-5/h6-9,14-15,19,23,28H,10-13H2,1-5H3 |
| InChIKey | QOCAHGZOYUIEQG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |