C30H34N2O2 — CID 10647393
methyl 4-(5,7,7,10,10-pentamethyl-8,9,12,13-tetrahydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate (PubChem CID 10647393) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is methyl 4-(5,7,7,10,10-pentamethyl-8,9,12,13-tetrahydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate.
| Compound Name | methyl 4-(5,7,7,10,10-pentamethyl-8,9,12,13-tetrahydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate |
|---|---|
| PubChem CID | 10647393 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | methyl 4-(5,7,7,10,10-pentamethyl-8,9,12,13-tetrahydronaphtho[2,3-b][1,5]benzodiazepin-12-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3ccccc3N(C)c3cc4c(cc32)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C30H34N2O2/c1-29(2)15-16-30(3,4)23-18-26-21(17-22(23)29)27(19-11-13-20(14-12-19)28(33)34-6)31-24-9-7-8-10-25(24)32(26)5/h7-14,17-18,27,31H,15-16H2,1-6H3 |
| InChIKey | SWSVGAKTACPKAK-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |