C21H23NO3 — CID 143004694
methyl 4-[(5S,10bS)-6-methyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate (PubChem CID 143004694) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 4-[(5S,10bS)-6-methyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate.
| Compound Name | methyl 4-[(5S,10bS)-6-methyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate |
|---|---|
| PubChem CID | 143004694 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl 4-[(5S,10bS)-6-methyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C3CCCO[C@@H]3c3ccccc3N2C)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-22-18-8-4-3-6-16(18)20-17(7-5-13-25-20)19(22)14-9-11-15(12-10-14)21(23)24-2/h3-4,6,8-12,17,19-20H,5,7,13H2,1-2H3/t17?,19-,20-/m1/s1 |
| InChIKey | DOLJSNITCCHWER-IPNZSQQUSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |