C27H27NO3 — CID 143004698
methyl 4-[(4aS,5S)-6-benzyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate (PubChem CID 143004698) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is methyl 4-[(4aS,5S)-6-benzyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate.
| Compound Name | methyl 4-[(4aS,5S)-6-benzyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate |
|---|---|
| PubChem CID | 143004698 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 4-[(4aS,5S)-6-benzyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2[C@@H]3CCCOC3c3ccccc3N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-30-27(29)21-15-13-20(14-16-21)25-23-11-7-17-31-26(23)22-10-5-6-12-24(22)28(25)18-19-8-3-2-4-9-19/h2-6,8-10,12-16,23,25-26H,7,11,17-18H2,1H3/t23-,25+,26?/m0/s1 |
| InChIKey | MYCGQOICFMPKHT-DFYOXDBWSA-N |
| XLogP | 5.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |