C21H23NO3 — CID 50813332
methyl 4-[(3aS,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]benzoate (PubChem CID 50813332) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 4-[(3aS,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]benzoate.
| Compound Name | methyl 4-[(3aS,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]benzoate |
|---|---|
| PubChem CID | 50813332 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl 4-[(3aS,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3c(C)cc(C)cc3[C@H]3OCC[C@@H]23)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-12-10-13(2)18-17(11-12)20-16(8-9-25-20)19(22-18)14-4-6-15(7-5-14)21(23)24-3/h4-7,10-11,16,19-20,22H,8-9H2,1-3H3/t16-,19?,20-/m0/s1 |
| InChIKey | BHAOHKJJOZNNRA-LIXNJBPUSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |