C19H20BrNO2 — CID 92894491
4-[(3aS,4R,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]-2-bromophenol (PubChem CID 92894491) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 4-[(3aS,4R,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]-2-bromophenol.
| Compound Name | 4-[(3aS,4R,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]-2-bromophenol |
|---|---|
| PubChem CID | 92894491 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-[(3aS,4R,9bS)-6,8-dimethyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-4-yl]-2-bromophenol |
| SMILES | Cc1cc(C)c2c(c1)[C@H]1OCC[C@H]1[C@H](c1ccc(O)c(Br)c1)N2 |
| InChI | InChI=1S/C19H20BrNO2/c1-10-7-11(2)17-14(8-10)19-13(5-6-23-19)18(21-17)12-3-4-16(22)15(20)9-12/h3-4,7-9,13,18-19,21-22H,5-6H2,1-2H3/t13-,18-,19-/m0/s1 |
| InChIKey | CIQUHVLYSKUYMO-AGRHKRQWSA-N |
| XLogP | 5.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |