C20H23NO2 — CID 75553160
3-(7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)phenol (PubChem CID 75553160) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)phenol.
| Compound Name | 3-(7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)phenol |
|---|---|
| PubChem CID | 75553160 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-(7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl)phenol |
| SMILES | Cc1cc(C)c2c(c1)C1OCCCC1C(c1cccc(O)c1)N2 |
| InChI | InChI=1S/C20H23NO2/c1-12-9-13(2)18-17(10-12)20-16(7-4-8-23-20)19(21-18)14-5-3-6-15(22)11-14/h3,5-6,9-11,16,19-22H,4,7-8H2,1-2H3 |
| InChIKey | UIEPEUPAGSSSFK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |