C21H25NOS — CID 46367415
(4aS,10bS)-7,9-dimethyl-5-(4-methylsulfanylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 46367415) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (4aS,10bS)-7,9-dimethyl-5-(4-methylsulfanylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,10bS)-7,9-dimethyl-5-(4-methylsulfanylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 46367415 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (4aS,10bS)-7,9-dimethyl-5-(4-methylsulfanylphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CSc1ccc(C2Nc3c(C)cc(C)cc3[C@H]3OCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C21H25NOS/c1-13-11-14(2)19-18(12-13)21-17(5-4-10-23-21)20(22-19)15-6-8-16(24-3)9-7-15/h6-9,11-12,17,20-22H,4-5,10H2,1-3H3/t17-,20?,21-/m0/s1 |
| InChIKey | DTOTXVBYTGBLOG-ZPWCZAOQSA-N |
| XLogP | 5.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |