C21H24ClNO2 — CID 92894445
(4aS,5R,10bS)-5-(3-chloro-4-methoxyphenyl)-7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 92894445) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(3-chloro-4-methoxyphenyl)-7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-(3-chloro-4-methoxyphenyl)-7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 92894445 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (4aS,5R,10bS)-5-(3-chloro-4-methoxyphenyl)-7,9-dimethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | COc1ccc([C@@H]2Nc3c(C)cc(C)cc3[C@H]3OCCC[C@H]32)cc1Cl |
| InChI | InChI=1S/C21H24ClNO2/c1-12-9-13(2)19-16(10-12)21-15(5-4-8-25-21)20(23-19)14-6-7-18(24-3)17(22)11-14/h6-7,9-11,15,20-21,23H,4-5,8H2,1-3H3/t15-,20-,21-/m0/s1 |
| InChIKey | AGRIZCCNJPVHPS-JHVJFLLYSA-N |
| XLogP | 5.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |