C28H32N2O8S — CID 10578710
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(3-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate (PubChem CID 10578710) has the molecular formula C28H32N2O8S and a molecular weight of 556.64 g/mol. Its IUPAC name is ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(3-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate.
| Compound Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(3-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate |
|---|---|
| PubChem CID | 10578710 |
| Molecular Formula | C28H32N2O8S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-1,3-bis(3-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]propanoate |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)C(=O)N(c2cccc(OC)c2)C(=S)N(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C28H32N2O8S/c1-5-37-23(31)13-15-28(16-14-24(32)38-6-2)25(33)29(19-9-7-11-21(17-19)35-3)27(39)30(26(28)34)20-10-8-12-22(18-20)36-4/h7-12,17-18H,5-6,13-16H2,1-4H3 |
| InChIKey | GXAXXIXVEYUFQX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|