C36H30O4S — CID 10578755
4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)phenol (PubChem CID 10578755) has the molecular formula C36H30O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is 4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)phenol.
| Compound Name | 4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)phenol |
|---|---|
| PubChem CID | 10578755 |
| Molecular Formula | C36H30O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2-(3,4,5-trimethoxyphenyl)phenol |
| SMILES | COc1cc(-c2cc(-c3ccc(-c4c(Cc5ccccc5)sc5ccccc45)cc3)ccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C36H30O4S/c1-38-31-21-27(22-32(39-2)36(31)40-3)29-20-26(17-18-30(29)37)24-13-15-25(16-14-24)35-28-11-7-8-12-33(28)41-34(35)19-23-9-5-4-6-10-23/h4-18,20-22,37H,19H2,1-3H3 |
| InChIKey | QYHGWSLVKKBLCG-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |