C40H29Br2NO5S — CID 54440153
methyl (2R)-2-[4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2,6-dibromophenoxy]-4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 54440153) has the molecular formula C40H29Br2NO5S and a molecular weight of 795.55 g/mol. Its IUPAC name is methyl (2R)-2-[4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2,6-dibromophenoxy]-4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | methyl (2R)-2-[4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2,6-dibromophenoxy]-4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 54440153 |
| Molecular Formula | C40H29Br2NO5S |
| Molecular Weight | 795.55 g/mol |
| Exact Mass | 793.01 |
| IUPAC Name | methyl (2R)-2-[4-[4-(2-benzyl-1-benzothiophen-3-yl)phenyl]-2,6-dibromophenoxy]-4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | COC(=O)[C@@H](CCN1C(=O)c2ccccc2C1=O)Oc1c(Br)cc(-c2ccc(-c3c(Cc4ccccc4)sc4ccccc34)cc2)cc1Br |
| InChI | InChI=1S/C40H29Br2NO5S/c1-47-40(46)33(19-20-43-38(44)28-11-5-6-12-29(28)39(43)45)48-37-31(41)22-27(23-32(37)42)25-15-17-26(18-16-25)36-30-13-7-8-14-34(30)49-35(36)21-24-9-3-2-4-10-24/h2-18,22-23,33H,19-21H2,1H3/t33-/m1/s1 |
| InChIKey | WNNKKTWKUKVPPX-MGBGTMOVSA-N |
| XLogP | 9.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.55 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|