C33H49NO5Si — CID 10578932
(4R)-4-benzhydryl-3-[(2R)-2-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]octanoyl]-1,3-oxazolidin-2-one (PubChem CID 10578932) has the molecular formula C33H49NO5Si and a molecular weight of 567.84 g/mol. Its IUPAC name is (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]octanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]octanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10578932 |
| Molecular Formula | C33H49NO5Si |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]octanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H](C(=O)N1C(=O)OC[C@H]1C(c1ccccc1)c1ccccc1)[C@@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H49NO5Si/c1-8-9-10-17-22-27(30(35)24(2)39-40(6,7)33(3,4)5)31(36)34-28(23-38-32(34)37)29(25-18-13-11-14-19-25)26-20-15-12-16-21-26/h11-16,18-21,24,27-30,35H,8-10,17,22-23H2,1-7H3/t24-,27+,28-,30-/m0/s1 |
| InChIKey | TXQXAQGJGOSCEF-HVZWKLCKSA-N |
| XLogP | 7.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|