C35H49NO4Si2 — CID 10579528
benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 10579528) has the molecular formula C35H49NO4Si2 and a molecular weight of 603.95 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10579528 |
| Molecular Formula | C35H49NO4Si2 |
| Molecular Weight | 603.95 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H49NO4Si2/c1-34(2,3)41(7,8)39-27-31-32(24-25-36(31)33(37)38-26-28-18-12-9-13-19-28)40-42(35(4,5)6,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h9-23,31-32H,24-27H2,1-8H3/t31-,32-/m0/s1 |
| InChIKey | JXEOSQKJCTWRDW-ACHIHNKUSA-N |
| XLogP | 7.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.95 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|