C56H56N2O6Zn — CID 10581625
4-[2-[6-[1-[3-(diethylcarbamoyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-yl]oxyhexoxy]naphthalen-1-yl]-N,N-diethyl-3-hydroxynaphthalene-2-carboxamide;zinc (PubChem CID 10581625) has the molecular formula C56H56N2O6Zn and a molecular weight of 918.46 g/mol. Its IUPAC name is 4-[2-[6-[1-[3-(diethylcarbamoyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-yl]oxyhexoxy]naphthalen-1-yl]-N,N-diethyl-3-hydroxynaphthalene-2-carboxamide;zinc.
| Compound Name | 4-[2-[6-[1-[3-(diethylcarbamoyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-yl]oxyhexoxy]naphthalen-1-yl]-N,N-diethyl-3-hydroxynaphthalene-2-carboxamide;zinc |
|---|---|
| PubChem CID | 10581625 |
| Molecular Formula | C56H56N2O6Zn |
| Molecular Weight | 918.46 g/mol |
| Exact Mass | 916.34 |
| IUPAC Name | 4-[2-[6-[1-[3-(diethylcarbamoyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-yl]oxyhexoxy]naphthalen-1-yl]-N,N-diethyl-3-hydroxynaphthalene-2-carboxamide;zinc |
| SMILES | CCN(CC)C(=O)c1cc2ccccc2c(-c2c(OCCCCCCOc3ccc4ccccc4c3-c3c(O)c(C(=O)N(CC)CC)cc4ccccc34)ccc3ccccc23)c1O.[Zn] |
| InChI | InChI=1S/C56H56N2O6.Zn/c1-5-57(6-2)55(61)45-35-39-23-13-17-27-43(39)51(53(45)59)49-41-25-15-11-21-37(41)29-31-47(49)63-33-19-9-10-20-34-64-48-32-30-38-22-12-16-26-42(38)50(48)52-44-28-18-14-24-40(44)36-46(54(52)60)56(62)58(7-3)8-4;/h11-18,21-32,35-36,59-60H,5-10,19-20,33-34H2,1-4H3; |
| InChIKey | LURXTLFFWNLSTN-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.46 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|