C26H25NO4 — CID 102371243
3-hydroxy-N-(4-hydroxybutyl)-4-(2-methoxynaphthalen-1-yl)naphthalene-2-carboxamide (PubChem CID 102371243) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-hydroxy-N-(4-hydroxybutyl)-4-(2-methoxynaphthalen-1-yl)naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-(4-hydroxybutyl)-4-(2-methoxynaphthalen-1-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 102371243 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-hydroxy-N-(4-hydroxybutyl)-4-(2-methoxynaphthalen-1-yl)naphthalene-2-carboxamide |
| SMILES | COc1ccc2ccccc2c1-c1c(O)c(C(=O)NCCCCO)cc2ccccc12 |
| InChI | InChI=1S/C26H25NO4/c1-31-22-13-12-17-8-2-4-10-19(17)23(22)24-20-11-5-3-9-18(20)16-21(25(24)29)26(30)27-14-6-7-15-28/h2-5,8-13,16,28-29H,6-7,14-15H2,1H3,(H,27,30) |
| InChIKey | DYHVEPNXTNNSJS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|