C25H31NO6 — CID 50905867
N-(6-hydroxyhexyl)-2,3,6,7-tetramethoxyphenanthrene-9-carboxamide (PubChem CID 50905867) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2,3,6,7-tetramethoxyphenanthrene-9-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-2,3,6,7-tetramethoxyphenanthrene-9-carboxamide |
|---|---|
| PubChem CID | 50905867 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-(6-hydroxyhexyl)-2,3,6,7-tetramethoxyphenanthrene-9-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCCCCCO)c3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C25H31NO6/c1-29-21-12-16-11-20(25(28)26-9-7-5-6-8-10-27)19-15-24(32-4)23(31-3)14-18(19)17(16)13-22(21)30-2/h11-15,27H,5-10H2,1-4H3,(H,26,28) |
| InChIKey | YPKOJDZXFQJLLK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|