C15H17ClO2 — CID 10582512
methyl (E,5E)-5-[(4-chlorophenyl)methylidene]hept-3-enoate (PubChem CID 10582512) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is methyl (E,5E)-5-[(4-chlorophenyl)methylidene]hept-3-enoate.
| Compound Name | methyl (E,5E)-5-[(4-chlorophenyl)methylidene]hept-3-enoate |
|---|---|
| PubChem CID | 10582512 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl (E,5E)-5-[(4-chlorophenyl)methylidene]hept-3-enoate |
| SMILES | CCC(/C=C/CC(=O)OC)=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO2/c1-3-12(5-4-6-15(17)18-2)11-13-7-9-14(16)10-8-13/h4-5,7-11H,3,6H2,1-2H3/b5-4+,12-11+ |
| InChIKey | CDKXTSBXIWZZJO-RUZVOTRSSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|