C17H22O4 — CID 10732248
methyl (E,5E)-5-[(3,4-dimethoxyphenyl)methylidene]hept-3-enoate (PubChem CID 10732248) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (E,5E)-5-[(3,4-dimethoxyphenyl)methylidene]hept-3-enoate.
| Compound Name | methyl (E,5E)-5-[(3,4-dimethoxyphenyl)methylidene]hept-3-enoate |
|---|---|
| PubChem CID | 10732248 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl (E,5E)-5-[(3,4-dimethoxyphenyl)methylidene]hept-3-enoate |
| SMILES | CCC(/C=C/CC(=O)OC)=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H22O4/c1-5-13(7-6-8-17(18)21-4)11-14-9-10-15(19-2)16(12-14)20-3/h6-7,9-12H,5,8H2,1-4H3/b7-6+,13-11+ |
| InChIKey | XISNFZHOXOMXRU-NLPDUVJUSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|