C20H27NO3 — CID 11956976
(E,4E)-4-[(3,4-dimethoxyphenyl)methylidene]-1-piperidin-1-ylhex-2-en-1-one (PubChem CID 11956976) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E,4E)-4-[(3,4-dimethoxyphenyl)methylidene]-1-piperidin-1-ylhex-2-en-1-one.
| Compound Name | (E,4E)-4-[(3,4-dimethoxyphenyl)methylidene]-1-piperidin-1-ylhex-2-en-1-one |
|---|---|
| PubChem CID | 11956976 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (E,4E)-4-[(3,4-dimethoxyphenyl)methylidene]-1-piperidin-1-ylhex-2-en-1-one |
| SMILES | CCC(/C=C/C(=O)N1CCCCC1)=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H27NO3/c1-4-16(9-11-20(22)21-12-6-5-7-13-21)14-17-8-10-18(23-2)19(15-17)24-3/h8-11,14-15H,4-7,12-13H2,1-3H3/b11-9+,16-14+ |
| InChIKey | SCBKKVXFYYVBTF-RHYUXORRSA-N |
| XLogP | 4.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|