C31H47N2O7P — CID 158881726
(E)-4-diethoxyphosphoryl-1-piperidin-1-ylbut-2-en-1-one;(2E,4E)-5-(3,4-dimethoxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 158881726) has the molecular formula C31H47N2O7P and a molecular weight of 590.70 g/mol. Its IUPAC name is (E)-4-diethoxyphosphoryl-1-piperidin-1-ylbut-2-en-1-one;(2E,4E)-5-(3,4-dimethoxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | (E)-4-diethoxyphosphoryl-1-piperidin-1-ylbut-2-en-1-one;(2E,4E)-5-(3,4-dimethoxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 158881726 |
| Molecular Formula | C31H47N2O7P |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | (E)-4-diethoxyphosphoryl-1-piperidin-1-ylbut-2-en-1-one;(2E,4E)-5-(3,4-dimethoxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | CCOP(=O)(C/C=C/C(=O)N1CCCCC1)OCC.COc1ccc(/C=C/C=C/C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H23NO3.C13H24NO4P/c1-21-16-11-10-15(14-17(16)22-2)8-4-5-9-18(20)19-12-6-3-7-13-19;1-3-17-19(16,18-4-2)12-8-9-13(15)14-10-6-5-7-11-14/h4-5,8-11,14H,3,6-7,12-13H2,1-2H3;8-9H,3-7,10-12H2,1-2H3/b8-4+,9-5+;9-8+ |
| InChIKey | JDCMNHOGKLVAQJ-AGMIXJJBSA-N |
| XLogP | 6.11 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|