C22H27NO2 — CID 73153109
4-[(2,2-dimethylchromen-6-yl)methylidene]-1-pyrrolidin-1-ylhex-2-en-1-one (PubChem CID 73153109) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-[(2,2-dimethylchromen-6-yl)methylidene]-1-pyrrolidin-1-ylhex-2-en-1-one.
| Compound Name | 4-[(2,2-dimethylchromen-6-yl)methylidene]-1-pyrrolidin-1-ylhex-2-en-1-one |
|---|---|
| PubChem CID | 73153109 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-[(2,2-dimethylchromen-6-yl)methylidene]-1-pyrrolidin-1-ylhex-2-en-1-one |
| SMILES | CCC(C=CC(=O)N1CCCC1)=Cc1ccc2c(c1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C22H27NO2/c1-4-17(8-10-21(24)23-13-5-6-14-23)15-18-7-9-20-19(16-18)11-12-22(2,3)25-20/h7-12,15-16H,4-6,13-14H2,1-3H3 |
| InChIKey | QHSWMLQKAFAPIH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|