C21H27NO4 — CID 44565530
(E,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-hydroxypiperidin-1-yl)oct-2-en-1-one (PubChem CID 44565530) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (E,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-hydroxypiperidin-1-yl)oct-2-en-1-one.
| Compound Name | (E,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-hydroxypiperidin-1-yl)oct-2-en-1-one |
|---|---|
| PubChem CID | 44565530 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (E,4E)-4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-hydroxypiperidin-1-yl)oct-2-en-1-one |
| SMILES | CCCCC(/C=C/C(=O)N1CCC(O)CC1)=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H27NO4/c1-2-3-4-16(6-8-21(24)22-11-9-18(23)10-12-22)13-17-5-7-19-20(14-17)26-15-25-19/h5-8,13-14,18,23H,2-4,9-12,15H2,1H3/b8-6+,16-13+ |
| InChIKey | YANLHWHHTGIJFK-MRGCPTAJSA-N |
| XLogP | 3.53 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|