C25H32O7 — CID 10582649
dimethyl (Z)-2-[(2R,4aR,4bR,8aS)-8a-methoxycarbonyl-1,4a,7-trimethyl-8-oxo-3,4,4b,5,9,10-hexahydro-2H-phenanthren-2-yl]but-2-enedioate (PubChem CID 10582649) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is dimethyl (Z)-2-[(2R,4aR,4bR,8aS)-8a-methoxycarbonyl-1,4a,7-trimethyl-8-oxo-3,4,4b,5,9,10-hexahydro-2H-phenanthren-2-yl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[(2R,4aR,4bR,8aS)-8a-methoxycarbonyl-1,4a,7-trimethyl-8-oxo-3,4,4b,5,9,10-hexahydro-2H-phenanthren-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 10582649 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | dimethyl (Z)-2-[(2R,4aR,4bR,8aS)-8a-methoxycarbonyl-1,4a,7-trimethyl-8-oxo-3,4,4b,5,9,10-hexahydro-2H-phenanthren-2-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)[C@@H]1CC[C@@]2(C)C(=C1C)CC[C@@]1(C(=O)OC)C(=O)C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H32O7/c1-14-7-8-19-24(3)11-9-16(17(22(28)31-5)13-20(26)30-4)15(2)18(24)10-12-25(19,21(14)27)23(29)32-6/h7,13,16,19H,8-12H2,1-6H3/b17-13-/t16-,19-,24+,25+/m1/s1 |
| InChIKey | WUQKQTBIUGYFBH-XUWRMDMCSA-N |
| XLogP | 3.48 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|