C7H7NO4 — CID 10583255
ethyl 2-formyl-1,3-oxazole-4-carboxylate (PubChem CID 10583255) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is ethyl 2-formyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-formyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 10583255 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | ethyl 2-formyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(C=O)n1 |
| InChI | InChI=1S/C7H7NO4/c1-2-11-7(10)5-4-12-6(3-9)8-5/h3-4H,2H2,1H3 |
| InChIKey | GCCVOQPMHVWBLV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|