C14H22O2 — CID 10585146
(3aR,4R,6R,7R,7aR)-7-ethenyl-4-hydroxy-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-2H-inden-1-one (PubChem CID 10585146) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-7-ethenyl-4-hydroxy-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-2H-inden-1-one.
| Compound Name | (3aR,4R,6R,7R,7aR)-7-ethenyl-4-hydroxy-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 10585146 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-7-ethenyl-4-hydroxy-3,3,6-trimethyl-3a,4,5,6,7,7a-hexahydro-2H-inden-1-one |
| SMILES | C=C[C@H]1[C@H]2C(=O)CC(C)(C)[C@@H]2[C@H](O)C[C@H]1C |
| InChI | InChI=1S/C14H22O2/c1-5-9-8(2)6-10(15)13-12(9)11(16)7-14(13,3)4/h5,8-10,12-13,15H,1,6-7H2,2-4H3/t8-,9-,10-,12+,13-/m1/s1 |
| InChIKey | BOLAYONAPBCYAP-HQPVMZNJSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|