C12H26O2Si — CID 10585581
[(E,4R,5R)-5-(methoxymethoxy)-4-methylhex-1-enyl]-trimethylsilane (PubChem CID 10585581) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is [(E,4R,5R)-5-(methoxymethoxy)-4-methylhex-1-enyl]-trimethylsilane.
| Compound Name | [(E,4R,5R)-5-(methoxymethoxy)-4-methylhex-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 10585581 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [(E,4R,5R)-5-(methoxymethoxy)-4-methylhex-1-enyl]-trimethylsilane |
| SMILES | COCO[C@H](C)[C@H](C)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-11(12(2)14-10-13-3)8-7-9-15(4,5)6/h7,9,11-12H,8,10H2,1-6H3/b9-7+/t11-,12-/m1/s1 |
| InChIKey | UTYWACPEZFWBSB-FUDMEFDJSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|