C15H22O3 — CID 10586778
(1'R,4'R,7'R,10'S)-5,5-dimethylspiro[1,3-dioxane-2,5'-tricyclo[5.2.1.04,10]decane]-2'-one (PubChem CID 10586778) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1'R,4'R,7'R,10'S)-5,5-dimethylspiro[1,3-dioxane-2,5'-tricyclo[5.2.1.04,10]decane]-2'-one.
| Compound Name | (1'R,4'R,7'R,10'S)-5,5-dimethylspiro[1,3-dioxane-2,5'-tricyclo[5.2.1.04,10]decane]-2'-one |
|---|---|
| PubChem CID | 10586778 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1'R,4'R,7'R,10'S)-5,5-dimethylspiro[1,3-dioxane-2,5'-tricyclo[5.2.1.04,10]decane]-2'-one |
| SMILES | CC1(C)COC2(C[C@H]3CC[C@H]4C(=O)C[C@@H]2[C@@H]34)OC1 |
| InChI | InChI=1S/C15H22O3/c1-14(2)7-17-15(18-8-14)6-9-3-4-10-12(16)5-11(15)13(9)10/h9-11,13H,3-8H2,1-2H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | AWJIAZDDMKWUES-XZUYRWCXSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |