C19H28O3 — CID 10017925
(1R,3aS,5aS,10aR,10bS)-1-propan-2-ylspiro[1,2,3,3a,5,5a,7,8,10a,10b-decahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-one (PubChem CID 10017925) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1R,3aS,5aS,10aR,10bS)-1-propan-2-ylspiro[1,2,3,3a,5,5a,7,8,10a,10b-decahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-one.
| Compound Name | (1R,3aS,5aS,10aR,10bS)-1-propan-2-ylspiro[1,2,3,3a,5,5a,7,8,10a,10b-decahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-one |
|---|---|
| PubChem CID | 10017925 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1R,3aS,5aS,10aR,10bS)-1-propan-2-ylspiro[1,2,3,3a,5,5a,7,8,10a,10b-decahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-one |
| SMILES | CC(C)[C@H]1CC[C@@H]2C(=O)C[C@H]3[C@H](C=CCCC34OCCO4)[C@@H]21 |
| InChI | InChI=1S/C19H28O3/c1-12(2)13-6-7-15-17(20)11-16-14(18(13)15)5-3-4-8-19(16)21-9-10-22-19/h3,5,12-16,18H,4,6-11H2,1-2H3/t13-,14+,15-,16+,18+/m1/s1 |
| InChIKey | FFGOHVJWNNZIDZ-OCABDXPQSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|