C16H24O — CID 10263367
(3R,3aS,5aS,9aR,9bS)-3-propan-2-yl-1,2,3,3a,5,5a,6,7,9a,9b-decahydrocyclopenta[a]naphthalen-4-one (PubChem CID 10263367) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (3R,3aS,5aS,9aR,9bS)-3-propan-2-yl-1,2,3,3a,5,5a,6,7,9a,9b-decahydrocyclopenta[a]naphthalen-4-one.
| Compound Name | (3R,3aS,5aS,9aR,9bS)-3-propan-2-yl-1,2,3,3a,5,5a,6,7,9a,9b-decahydrocyclopenta[a]naphthalen-4-one |
|---|---|
| PubChem CID | 10263367 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (3R,3aS,5aS,9aR,9bS)-3-propan-2-yl-1,2,3,3a,5,5a,6,7,9a,9b-decahydrocyclopenta[a]naphthalen-4-one |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@H]3C=CCC[C@H]3CC(=O)[C@H]21 |
| InChI | InChI=1S/C16H24O/c1-10(2)12-7-8-14-13-6-4-3-5-11(13)9-15(17)16(12)14/h4,6,10-14,16H,3,5,7-9H2,1-2H3/t11-,12+,13-,14-,16-/m0/s1 |
| InChIKey | GYGGPDHAQHEZDB-RGHULWKBSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|