C11H13FNO3P — CID 10587224
2-[(1R,3aS)-1-oxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]-3-fluorophenol (PubChem CID 10587224) has the molecular formula C11H13FNO3P and a molecular weight of 257.20 g/mol. Its IUPAC name is 2-[(1R,3aS)-1-oxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]-3-fluorophenol.
| Compound Name | 2-[(1R,3aS)-1-oxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]-3-fluorophenol |
|---|---|
| PubChem CID | 10587224 |
| Molecular Formula | C11H13FNO3P |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[(1R,3aS)-1-oxo-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]-3-fluorophenol |
| SMILES | O=[P@]1(c2c(O)cccc2F)OC[C@@H]2CCCN21 |
| InChI | InChI=1S/C11H13FNO3P/c12-9-4-1-5-10(14)11(9)17(15)13-6-2-3-8(13)7-16-17/h1,4-5,8,14H,2-3,6-7H2/t8-,17+/m0/s1 |
| InChIKey | CXOGSCPZWWBJRG-WNWIJWBNSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|