C12H14O7 — CID 10588085
methyl (1R,5R)-1,5-diacetyloxy-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 10588085) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is methyl (1R,5R)-1,5-diacetyloxy-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-1,5-diacetyloxy-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10588085 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | methyl (1R,5R)-1,5-diacetyloxy-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)=O)C=CC(=O)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C12H14O7/c1-7(13)18-10-6-12(11(16)17-3,19-8(2)14)5-4-9(10)15/h4-5,10H,6H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | OUAWDFCGELMOEK-PWSUYJOCSA-N |
| XLogP | -0.08 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|