C13H12O7 — CID 57279696
dimethyl 5,8-dioxo-1,4-dihydroisochromene-3,3-dicarboxylate (PubChem CID 57279696) has the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. Its IUPAC name is dimethyl 5,8-dioxo-1,4-dihydroisochromene-3,3-dicarboxylate.
| Compound Name | dimethyl 5,8-dioxo-1,4-dihydroisochromene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 57279696 |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | dimethyl 5,8-dioxo-1,4-dihydroisochromene-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(CO1)C(=O)C=CC2=O |
| InChI | InChI=1S/C13H12O7/c1-18-11(16)13(12(17)19-2)5-7-8(6-20-13)10(15)4-3-9(7)14/h3-4H,5-6H2,1-2H3 |
| InChIKey | ICSUPGQBYJSQMI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|