C12H11ClN4O2 — CID 10588704
5-amino-N-[(E)-(3-chlorophenyl)methylideneamino]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 10588704) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 5-amino-N-[(E)-(3-chlorophenyl)methylideneamino]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-amino-N-[(E)-(3-chlorophenyl)methylideneamino]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10588704 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-amino-N-[(E)-(3-chlorophenyl)methylideneamino]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(N)c1C(=O)N/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClN4O2/c1-7-10(11(14)19-17-7)12(18)16-15-6-8-3-2-4-9(13)5-8/h2-6H,14H2,1H3,(H,16,18)/b15-6+ |
| InChIKey | OQRNENYCHMVFHB-GIDUJCDVSA-N |
| XLogP | 1.98 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|