C10H10Cl2Se — CID 10588787
[(E)-1,2-dichloro-2-ethylselanylethenyl]benzene (PubChem CID 10588787) has the molecular formula C10H10Cl2Se and a molecular weight of 280.06 g/mol. Its IUPAC name is [(E)-1,2-dichloro-2-ethylselanylethenyl]benzene.
| Compound Name | [(E)-1,2-dichloro-2-ethylselanylethenyl]benzene |
|---|---|
| PubChem CID | 10588787 |
| Molecular Formula | C10H10Cl2Se |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | [(E)-1,2-dichloro-2-ethylselanylethenyl]benzene |
| SMILES | CC[Se]/C(Cl)=C(/Cl)c1ccccc1 |
| InChI | InChI=1S/C10H10Cl2Se/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7H,2H2,1H3/b10-9+ |
| InChIKey | ZAQVFSGESHSLQV-MDZDMXLPSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|