C16H14Cl2 — CID 88704191
1-[(Z)-1,3-dichloro-2-phenylprop-1-enyl]-4-methylbenzene (PubChem CID 88704191) has the molecular formula C16H14Cl2 and a molecular weight of 277.19 g/mol. Its IUPAC name is 1-[(Z)-1,3-dichloro-2-phenylprop-1-enyl]-4-methylbenzene.
| Compound Name | 1-[(Z)-1,3-dichloro-2-phenylprop-1-enyl]-4-methylbenzene |
|---|---|
| PubChem CID | 88704191 |
| Molecular Formula | C16H14Cl2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-[(Z)-1,3-dichloro-2-phenylprop-1-enyl]-4-methylbenzene |
| SMILES | Cc1ccc(/C(Cl)=C(/CCl)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14Cl2/c1-12-7-9-14(10-8-12)16(18)15(11-17)13-5-3-2-4-6-13/h2-10H,11H2,1H3/b16-15+ |
| InChIKey | RABJYVHXOHXCSK-FOCLMDBBSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|