C10H22NO6P — CID 10589016
(2S,3R,4R,5R)-2-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 10589016) has the molecular formula C10H22NO6P and a molecular weight of 283.26 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10589016 |
| Molecular Formula | C10H22NO6P |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2S,3R,4R,5R)-2-(diethoxyphosphorylmethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | CCOP(=O)(C[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C10H22NO6P/c1-3-16-18(15,17-4-2)6-8-10(14)9(13)7(5-12)11-8/h7-14H,3-6H2,1-2H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | CONPBQIOPFXIFF-ZYUZMQFOSA-N |
| XLogP | -0.69 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|