About 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene
1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene (PubChem CID 10589610) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene |
| PubChem CID | 10589610 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene |
| SMILES | C/C=C(/CC/C(=C/C)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26/c1-5-19(21-11-7-17(3)8-12-21)15-16-20(6-2)22-13-9-18(4)10-14-22/h5-14H,15-16H2,1-4H3/b19-5-,20-6- |
| InChIKey | UAVXADRUCQBBPD-FDWQPRGYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene?
The IUPAC name of 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene (CID 10589610) is 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene.
What is the SMILES notation for 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene?
The canonical SMILES for 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene is C/C=C(/CC/C(=C/C)c1ccc(C)cc1)c1ccc(C)cc1.
What is the InChIKey of 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene?
The InChIKey is UAVXADRUCQBBPD-FDWQPRGYSA-N. The full InChI is InChI=1S/C22H26/c1-5-19(21-11-7-17(3)8-12-21)15-16-20(6-2)22-13-9-18(4)10-14-22/h5-14H,15-16H2,1-4H3/b19-5-,20-6-.
What are the key properties of 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene?
1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene has a molecular weight of 290.45 g/mol, XLogP of 6.59, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(2Z,6Z)-6-(4-methylphenyl)octa-2,6-dien-3-yl]benzene is sourced from PubChem (CID 10589610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).